C14H16FN5O5S — CID 137287912
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-(3-sulfamoylpropoxy)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137287912) has the molecular formula C14H16FN5O5S and a molecular weight of 385.38 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-(3-sulfamoylpropoxy)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-(3-sulfamoylpropoxy)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137287912 |
| Molecular Formula | C14H16FN5O5S |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-(3-sulfamoylpropoxy)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)CCCOc1nonc1/C(=N/[C@H]1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C14H16FN5O5S/c15-9-3-2-8-6-11(10(8)7-9)17-13(18-21)12-14(20-25-19-12)24-4-1-5-26(16,22)23/h2-3,7,11,21H,1,4-6H2,(H,17,18)(H2,16,22,23)/t11-/m0/s1 |
| InChIKey | SXFYOMZOXUCNIF-NSHDSACASA-N |
| XLogP | 0.29 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|