About 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one
6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 137288238) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| PubChem CID | 137288238 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2[nH]c(CO)cc12 |
| InChI | InChI=1S/C7H7N3O2/c11-2-4-1-5-6(10-4)8-3-9-7(5)12/h1,3,11H,2H2,(H2,8,9,10,12) |
| InChIKey | OCWNJDQAPJOZTJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The IUPAC name of 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (CID 137288238) is 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is O=c1[nH]cnc2[nH]c(CO)cc12.
What is the InChIKey of 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
The InChIKey is OCWNJDQAPJOZTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c11-2-4-1-5-6(10-4)8-3-9-7(5)12/h1,3,11H,2H2,(H2,8,9,10,12).
What are the key properties of 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one?
6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one has a molecular weight of 165.15 g/mol, XLogP of -0.26, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 137288238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).