C7H6N8O2S — CID 137288293
2-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione (PubChem CID 137288293) has the molecular formula C7H6N8O2S and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione.
| Compound Name | 2-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 137288293 |
| Molecular Formula | C7H6N8O2S |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-(4-amino-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-7H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
| SMILES | Nn1c(-n2cc3c(=O)[nH]c(=O)[nH]c3n2)n[nH]c1=S |
| InChI | InChI=1S/C7H6N8O2S/c8-15-6(11-12-7(15)18)14-1-2-3(13-14)9-5(17)10-4(2)16/h1H,8H2,(H,12,18)(H2,9,10,13,16,17) |
| InChIKey | BFNAAOQJXBEKDF-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|