C14H19N7 — CID 137288467
(2Z,4Z)-5-(methylamino)-N-[(E)-C-methyl-N-[(E)-(1-methyl-2-pyridinylidene)amino]carbonimidoyl]iminopenta-2,4-dienimidamide (PubChem CID 137288467) has the molecular formula C14H19N7 and a molecular weight of 285.36 g/mol. Its IUPAC name is (2Z,4Z)-5-(methylamino)-N-[(E)-C-methyl-N-[(E)-(1-methyl-2-pyridinylidene)amino]carbonimidoyl]iminopenta-2,4-dienimidamide.
| Compound Name | (2Z,4Z)-5-(methylamino)-N-[(E)-C-methyl-N-[(E)-(1-methyl-2-pyridinylidene)amino]carbonimidoyl]iminopenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 137288467 |
| Molecular Formula | C14H19N7 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2Z,4Z)-5-(methylamino)-N-[(E)-C-methyl-N-[(E)-(1-methyl-2-pyridinylidene)amino]carbonimidoyl]iminopenta-2,4-dienimidamide |
| SMILES | [H]/N=C(/C=C\C=C/NC)\N=N\C(C)=N\N=c1/ccccn1C |
| InChI | InChI=1S/C14H19N7/c1-12(17-19-13(15)8-4-6-10-16-2)18-20-14-9-5-7-11-21(14)3/h4-11,15-16H,1-3H3/b8-4-,10-6-,15-13-,18-12+,19-17+,20-14+ |
| InChIKey | YIBJKPFMPBZLQD-KMWPVSMRSA-N |
| XLogP | 1.98 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|