C23H29N5O2S — CID 137288673
3-[4-(2,2-dimethylpyrrolidin-1-yl)sulfanylanilino]-1-(oxan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 137288673) has the molecular formula C23H29N5O2S and a molecular weight of 439.59 g/mol. Its IUPAC name is 3-[4-(2,2-dimethylpyrrolidin-1-yl)sulfanylanilino]-1-(oxan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 3-[4-(2,2-dimethylpyrrolidin-1-yl)sulfanylanilino]-1-(oxan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 137288673 |
| Molecular Formula | C23H29N5O2S |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-[4-(2,2-dimethylpyrrolidin-1-yl)sulfanylanilino]-1-(oxan-3-yl)-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | CC1(C)CCCN1Sc1ccc(Nc2nn(C3CCCOC3)c3cc[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C23H29N5O2S/c1-23(2)11-4-13-27(23)31-18-8-6-16(7-9-18)25-21-20-19(10-12-24-22(20)29)28(26-21)17-5-3-14-30-15-17/h6-10,12,17H,3-5,11,13-15H2,1-2H3,(H,24,29)(H,25,26) |
| InChIKey | VIMVXFXLRCMATJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|