C29H38N6O6S — CID 137288680
propan-2-yl (2S,5S)-5-[3-[(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-5-yl)amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]-5-[2-(methylideneamino)ethyl]oxane-2-carboxylate (PubChem CID 137288680) has the molecular formula C29H38N6O6S and a molecular weight of 598.73 g/mol. Its IUPAC name is propan-2-yl (2S,5S)-5-[3-[(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-5-yl)amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]-5-[2-(methylideneamino)ethyl]oxane-2-carboxylate.
| Compound Name | propan-2-yl (2S,5S)-5-[3-[(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-5-yl)amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]-5-[2-(methylideneamino)ethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 137288680 |
| Molecular Formula | C29H38N6O6S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | propan-2-yl (2S,5S)-5-[3-[(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-5-yl)amino]-4-oxo-5H-pyrazolo[4,3-c]pyridin-1-yl]-5-[2-(methylideneamino)ethyl]oxane-2-carboxylate |
| SMILES | C=NCC[C@@]1(n2nc(Nc3ccc4c(c3)CN(C(C)(C)C)S4(=O)=O)c3c(=O)[nH]ccc32)CC[C@@H](C(=O)OC(C)C)OC1 |
| InChI | InChI=1S/C29H38N6O6S/c1-18(2)41-27(37)22-9-11-29(17-40-22,12-14-30-6)35-21-10-13-31-26(36)24(21)25(33-35)32-20-7-8-23-19(15-20)16-34(28(3,4)5)42(23,38)39/h7-8,10,13,15,18,22H,6,9,11-12,14,16-17H2,1-5H3,(H,31,36)(H,32,33)/t22-,29-/m0/s1 |
| InChIKey | UKOLXOVYNJVPLV-ZTOMLWHTSA-N |
| XLogP | 3.69 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|