C14H15ClFN5O — CID 137288968
5-chloro-2-(2-fluoro-4-pyridinyl)-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 137288968) has the molecular formula C14H15ClFN5O and a molecular weight of 323.76 g/mol. Its IUPAC name is 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137288968 |
| Molecular Formula | C14H15ClFN5O |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | C[C@H]1CN(c2nc(-c3ccnc(F)c3)[nH]c(=O)c2Cl)CCN1 |
| InChI | InChI=1S/C14H15ClFN5O/c1-8-7-21(5-4-17-8)13-11(15)14(22)20-12(19-13)9-2-3-18-10(16)6-9/h2-3,6,8,17H,4-5,7H2,1H3,(H,19,20,22)/t8-/m0/s1 |
| InChIKey | RQGKPPOMVZMUDP-QMMMGPOBSA-N |
| XLogP | 1.42 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|