C14H12ClF4N5O — CID 137288969
5-chloro-2-(2-fluoro-4-pyridinyl)-4-[2-(trifluoromethyl)piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 137288969) has the molecular formula C14H12ClF4N5O and a molecular weight of 377.73 g/mol. Its IUPAC name is 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[2-(trifluoromethyl)piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[2-(trifluoromethyl)piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137288969 |
| Molecular Formula | C14H12ClF4N5O |
| Molecular Weight | 377.73 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[2-(trifluoromethyl)piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccnc(F)c2)nc(N2CCNCC2C(F)(F)F)c1Cl |
| InChI | InChI=1S/C14H12ClF4N5O/c15-10-12(24-4-3-20-6-8(24)14(17,18)19)22-11(23-13(10)25)7-1-2-21-9(16)5-7/h1-2,5,8,20H,3-4,6H2,(H,22,23,25) |
| InChIKey | WSUVGOGWBGVLGI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.73 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|