About 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline
8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline (PubChem CID 137289635) has the molecular formula C12H8F2N2
and a molecular weight of 218.21 g/mol. Its IUPAC name is 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline.
Molecular Properties
| Compound Name | 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline |
| PubChem CID | 137289635 |
| Molecular Formula | C12H8F2N2 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline |
| SMILES | FC(F)c1ccc2ccc3ccnc3c2[nH]1 |
| InChI | InChI=1S/C12H8F2N2/c13-12(14)9-4-3-7-1-2-8-5-6-15-10(8)11(7)16-9/h1-6,12,16H |
| InChIKey | UHEGBKKACTWFPC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline?
The IUPAC name of 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline (CID 137289635) is 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline.
What is the SMILES notation for 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline?
The canonical SMILES for 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline is FC(F)c1ccc2ccc3ccnc3c2[nH]1.
What is the InChIKey of 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline?
The InChIKey is UHEGBKKACTWFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F2N2/c13-12(14)9-4-3-7-1-2-8-5-6-15-10(8)11(7)16-9/h1-6,12,16H.
What are the key properties of 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline?
8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline has a molecular weight of 218.21 g/mol, XLogP of 3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(difluoromethyl)-9H-pyrrolo[3,2-h]quinoline is sourced from PubChem (CID 137289635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).