C25H34N6O4 — CID 137289892
3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypropanamide (PubChem CID 137289892) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is 3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypropanamide.
| Compound Name | 3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 137289892 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 3-[4-[[4-ethoxy-3-(3-ethyl-1-methyl-7-oxo-6H-pyrazolo[4,5-d]pyrimidin-5-yl)phenyl]methyl]piperidin-1-yl]-N-hydroxypropanamide |
| SMILES | CCOc1ccc(CC2CCN(CCC(=O)NO)CC2)cc1-c1nc2c(CC)nn(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C25H34N6O4/c1-4-19-22-23(30(3)28-19)25(33)27-24(26-22)18-15-17(6-7-20(18)35-5-2)14-16-8-11-31(12-9-16)13-10-21(32)29-34/h6-7,15-16,34H,4-5,8-14H2,1-3H3,(H,29,32)(H,26,27,33) |
| InChIKey | CCVHSGSLBUVOTK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|