C22H19N5OS — CID 137290150
2-[[5-(1H-indol-3-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide (PubChem CID 137290150) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-[[5-(1H-indol-3-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[5-(1H-indol-3-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 137290150 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[[5-(1H-indol-3-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1nnc(-c2c[nH]c3ccccc23)n1-c1ccccc1C |
| InChI | InChI=1S/C22H19N5OS/c1-3-12-23-20(28)14-29-22-26-25-21(27(22)19-11-7-4-8-15(19)2)17-13-24-18-10-6-5-9-16(17)18/h1,4-11,13,24H,12,14H2,2H3,(H,23,28) |
| InChIKey | LWPUWEOSAPRJFQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|