C16H24N2S2 — CID 137290210
4,4,8-trimethyl-N-(thiophen-2-ylmethyl)-1-thia-3-azaspiro[4.5]decan-2-imine (PubChem CID 137290210) has the molecular formula C16H24N2S2 and a molecular weight of 308.52 g/mol. Its IUPAC name is 4,4,8-trimethyl-N-(thiophen-2-ylmethyl)-1-thia-3-azaspiro[4.5]decan-2-imine.
| Compound Name | 4,4,8-trimethyl-N-(thiophen-2-ylmethyl)-1-thia-3-azaspiro[4.5]decan-2-imine |
|---|---|
| PubChem CID | 137290210 |
| Molecular Formula | C16H24N2S2 |
| Molecular Weight | 308.52 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4,4,8-trimethyl-N-(thiophen-2-ylmethyl)-1-thia-3-azaspiro[4.5]decan-2-imine |
| SMILES | CC1CCC2(CC1)S/C(=N\Cc1cccs1)NC2(C)C |
| InChI | InChI=1S/C16H24N2S2/c1-12-6-8-16(9-7-12)15(2,3)18-14(20-16)17-11-13-5-4-10-19-13/h4-5,10,12H,6-9,11H2,1-3H3,(H,17,18) |
| InChIKey | CTMZIGQAIPLWEA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|