C23H16F3N5O2 — CID 137290300
ethyl 4-phenyl-6-(1H-pyrrol-2-yl)-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-12-carboxylate (PubChem CID 137290300) has the molecular formula C23H16F3N5O2 and a molecular weight of 451.41 g/mol. Its IUPAC name is ethyl 4-phenyl-6-(1H-pyrrol-2-yl)-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-12-carboxylate.
| Compound Name | ethyl 4-phenyl-6-(1H-pyrrol-2-yl)-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 137290300 |
| Molecular Formula | C23H16F3N5O2 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | ethyl 4-phenyl-6-(1H-pyrrol-2-yl)-11-(trifluoromethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-12-carboxylate |
| SMILES | CCOC(=O)c1cc2c(nc1C(F)(F)F)nn1c(-c3ccc[nH]3)cc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C23H16F3N5O2/c1-2-33-22(32)14-11-15-20(29-19(14)23(24,25)26)30-31-18(16-9-6-10-27-16)12-17(28-21(15)31)13-7-4-3-5-8-13/h3-12,27H,2H2,1H3 |
| InChIKey | QPNIBTMYYNGXPM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |