C22H21ClFN3O2 — CID 137290608
N-[2-[[4-(4-chloro-3-fluorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 137290608) has the molecular formula C22H21ClFN3O2 and a molecular weight of 413.88 g/mol. Its IUPAC name is N-[2-[[4-(4-chloro-3-fluorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[4-(4-chloro-3-fluorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 137290608 |
| Molecular Formula | C22H21ClFN3O2 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[2-[[4-(4-chloro-3-fluorophenyl)-6-(2-hydroxy-5-methylphenyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(-c2ccc(Cl)c(F)c2)cc(-c2cc(C)ccc2O)n1 |
| InChI | InChI=1S/C22H21ClFN3O2/c1-13-3-6-21(29)17(9-13)20-11-16(15-4-5-18(23)19(24)10-15)12-22(27-20)26-8-7-25-14(2)28/h3-6,9-12,29H,7-8H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | MPAQLMNGEGLELP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|