C18H19N5O — CID 137291154
3-methyl-14-methylidene-10-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4,6,8,15(22),16,19-heptaene (PubChem CID 137291154) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-methyl-14-methylidene-10-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4,6,8,15(22),16,19-heptaene.
| Compound Name | 3-methyl-14-methylidene-10-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4,6,8,15(22),16,19-heptaene |
|---|---|
| PubChem CID | 137291154 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-methyl-14-methylidene-10-oxa-2,13,17,18,21-pentazatetracyclo[13.5.2.04,9.018,22]docosa-1(21),4,6,8,15(22),16,19-heptaene |
| SMILES | C=C1NCCOc2ccccc2C(C)Nc2ccn3ncc1c3n2 |
| InChI | InChI=1S/C18H19N5O/c1-12-15-11-20-23-9-7-17(22-18(15)23)21-13(2)14-5-3-4-6-16(14)24-10-8-19-12/h3-7,9,11,13,19H,1,8,10H2,2H3,(H,21,22) |
| InChIKey | OAFDNTSMLRZJCR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |