C18H17ClN6O2 — CID 137291269
5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-2-pyridin-2-yl-4H-1,2,4-triazol-3-one (PubChem CID 137291269) has the molecular formula C18H17ClN6O2 and a molecular weight of 384.83 g/mol. Its IUPAC name is 5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-2-pyridin-2-yl-4H-1,2,4-triazol-3-one.
| Compound Name | 5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-2-pyridin-2-yl-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 137291269 |
| Molecular Formula | C18H17ClN6O2 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-2-pyridin-2-yl-4H-1,2,4-triazol-3-one |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCC(c2nn(-c3ccccn3)c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C18H17ClN6O2/c19-14-5-4-13(11-21-14)17(26)24-9-6-12(7-10-24)16-22-18(27)25(23-16)15-3-1-2-8-20-15/h1-5,8,11-12H,6-7,9-10H2,(H,22,23,27) |
| InChIKey | BBKRMMRFIQFZBK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|