About 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine
3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine (PubChem CID 137291308) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine.
Molecular Properties
| Compound Name | 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine |
| PubChem CID | 137291308 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine |
| SMILES | CCC1C=CN/C1=N\C |
| InChI | InChI=1S/C7H12N2/c1-3-6-4-5-9-7(6)8-2/h4-6H,3H2,1-2H3,(H,8,9) |
| InChIKey | MNEONGNPYVANFZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine?
The IUPAC name of 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine (CID 137291308) is 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine.
What is the SMILES notation for 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine?
The canonical SMILES for 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine is CCC1C=CN/C1=N\C.
What is the InChIKey of 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine?
The InChIKey is MNEONGNPYVANFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-6-4-5-9-7(6)8-2/h4-6H,3H2,1-2H3,(H,8,9).
What are the key properties of 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine?
3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine has a molecular weight of 124.19 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-methyl-1,3-dihydropyrrol-2-imine is sourced from PubChem (CID 137291308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).