C16H19ClFN5O — CID 137291595
5-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one (PubChem CID 137291595) has the molecular formula C16H19ClFN5O and a molecular weight of 351.81 g/mol. Its IUPAC name is 5-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137291595 |
| Molecular Formula | C16H19ClFN5O |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 5-chloro-4-(2,4-dimethyl-1,4-diazepan-1-yl)-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
| SMILES | CC1CN(C)CCCN1c1nc(-c2ccnc(F)c2)[nH]c(=O)c1Cl |
| InChI | InChI=1S/C16H19ClFN5O/c1-10-9-22(2)6-3-7-23(10)15-13(17)16(24)21-14(20-15)11-4-5-19-12(18)8-11/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,20,21,24) |
| InChIKey | UUDGNXVGEHAUFU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|