C17H13ClN4O — CID 137291922
3-anilino-6-[(E)-2-(4-chlorophenyl)ethenyl]-4H-1,2,4-triazin-5-one (PubChem CID 137291922) has the molecular formula C17H13ClN4O and a molecular weight of 324.77 g/mol. Its IUPAC name is 3-anilino-6-[(E)-2-(4-chlorophenyl)ethenyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-anilino-6-[(E)-2-(4-chlorophenyl)ethenyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 137291922 |
| Molecular Formula | C17H13ClN4O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3-anilino-6-[(E)-2-(4-chlorophenyl)ethenyl]-4H-1,2,4-triazin-5-one |
| SMILES | O=c1[nH]c(Nc2ccccc2)nnc1/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN4O/c18-13-9-6-12(7-10-13)8-11-15-16(23)20-17(22-21-15)19-14-4-2-1-3-5-14/h1-11H,(H2,19,20,22,23)/b11-8+ |
| InChIKey | VXEVMCLFRLFCRD-DHZHZOJOSA-N |
| XLogP | 3.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |