About 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate
2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate (PubChem CID 137292047) has the molecular formula C12H11FN2O2
and a molecular weight of 234.23 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate |
| PubChem CID | 137292047 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate |
| SMILES | C=C(C)COC(=O)C(=[N+]=[N-])c1ccccc1F |
| InChI | InChI=1S/C12H11FN2O2/c1-8(2)7-17-12(16)11(15-14)9-5-3-4-6-10(9)13/h3-6H,1,7H2,2H3 |
| InChIKey | GWDZDGLLJPOZIJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate?
The IUPAC name of 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate (CID 137292047) is 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate.
What is the SMILES notation for 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate?
The canonical SMILES for 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate is C=C(C)COC(=O)C(=[N+]=[N-])c1ccccc1F.
What is the InChIKey of 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate?
The InChIKey is GWDZDGLLJPOZIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O2/c1-8(2)7-17-12(16)11(15-14)9-5-3-4-6-10(9)13/h3-6H,1,7H2,2H3.
What are the key properties of 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate?
2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate has a molecular weight of 234.23 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl 2-diazo-2-(2-fluorophenyl)acetate is sourced from PubChem (CID 137292047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).