C37H24N4O — CID 137292081
4-methyl-2,6-bis(1H-phenanthro[9,10-d]imidazol-2-yl)phenol (PubChem CID 137292081) has the molecular formula C37H24N4O and a molecular weight of 540.63 g/mol. Its IUPAC name is 4-methyl-2,6-bis(1H-phenanthro[9,10-d]imidazol-2-yl)phenol.
| Compound Name | 4-methyl-2,6-bis(1H-phenanthro[9,10-d]imidazol-2-yl)phenol |
|---|---|
| PubChem CID | 137292081 |
| Molecular Formula | C37H24N4O |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 4-methyl-2,6-bis(1H-phenanthro[9,10-d]imidazol-2-yl)phenol |
| SMILES | Cc1cc(-c2nc3c4ccccc4c4ccccc4c3[nH]2)c(O)c(-c2nc3c4ccccc4c4ccccc4c3[nH]2)c1 |
| InChI | InChI=1S/C37H24N4O/c1-20-18-29(36-38-31-25-14-6-2-10-21(25)22-11-3-7-15-26(22)32(31)39-36)35(42)30(19-20)37-40-33-27-16-8-4-12-23(27)24-13-5-9-17-28(24)34(33)41-37/h2-19,42H,1H3,(H,38,39)(H,40,41) |
| InChIKey | SPNDWDSMUVWZRZ-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|