About ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate
ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 137292161) has the molecular formula C24H22N2O3
and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate |
| PubChem CID | 137292161 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(/C(=N\c1ccccc1)Nc1ccccc1)=C(/O)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O3/c1-2-29-24(28)21(22(27)18-12-6-3-7-13-18)23(25-19-14-8-4-9-15-19)26-20-16-10-5-11-17-20/h3-17,27H,2H2,1H3,(H,25,26)/b22-21+ |
| InChIKey | RUEVJURCDYCIAL-QURGRASLSA-N |
| XLogP | 5.36 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate?
The IUPAC name of ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate (CID 137292161) is ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate.
What is the SMILES notation for ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate?
The canonical SMILES for ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate is CCOC(=O)C(/C(=N\c1ccccc1)Nc1ccccc1)=C(/O)c1ccccc1.
What is the InChIKey of ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate?
The InChIKey is RUEVJURCDYCIAL-QURGRASLSA-N. The full InChI is InChI=1S/C24H22N2O3/c1-2-29-24(28)21(22(27)18-12-6-3-7-13-18)23(25-19-14-8-4-9-15-19)26-20-16-10-5-11-17-20/h3-17,27H,2H2,1H3,(H,25,26)/b22-21+.
What are the key properties of ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate?
ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate has a molecular weight of 386.45 g/mol, XLogP of 5.36, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-(N,N'-diphenylcarbamimidoyl)-3-hydroxy-3-phenylprop-2-enoate is sourced from PubChem (CID 137292161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).