C15H11FN2OS — CID 137292300
2-(4-fluorophenyl)imino-5-phenyl-1,3-thiazolidin-4-one (PubChem CID 137292300) has the molecular formula C15H11FN2OS and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)imino-5-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-fluorophenyl)imino-5-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137292300 |
| Molecular Formula | C15H11FN2OS |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(4-fluorophenyl)imino-5-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(F)cc2)SC1c1ccccc1 |
| InChI | InChI=1S/C15H11FN2OS/c16-11-6-8-12(9-7-11)17-15-18-14(19)13(20-15)10-4-2-1-3-5-10/h1-9,13H,(H,17,18,19) |
| InChIKey | NROYZCUWSQVKCH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|