C10H18N2OS — CID 137292366
2-tert-butylimino-5-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 137292366) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-tert-butylimino-5-propan-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-tert-butylimino-5-propan-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137292366 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-tert-butylimino-5-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC(C)C1S/C(=N\C(C)(C)C)NC1=O |
| InChI | InChI=1S/C10H18N2OS/c1-6(2)7-8(13)11-9(14-7)12-10(3,4)5/h6-7H,1-5H3,(H,11,12,13) |
| InChIKey | BFPXQBOFERTWIG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|