C22H22N6O — CID 137292412
[3-(1H-benzimidazol-2-yl)-1H-indazol-6-yl]-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 137292412) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-1H-indazol-6-yl]-(4-prop-2-enylpiperazin-1-yl)methanone.
| Compound Name | [3-(1H-benzimidazol-2-yl)-1H-indazol-6-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 137292412 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-1H-indazol-6-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)c2ccc3c(-c4nc5ccccc5[nH]4)n[nH]c3c2)CC1 |
| InChI | InChI=1S/C22H22N6O/c1-2-9-27-10-12-28(13-11-27)22(29)15-7-8-16-19(14-15)25-26-20(16)21-23-17-5-3-4-6-18(17)24-21/h2-8,14H,1,9-13H2,(H,23,24)(H,25,26) |
| InChIKey | ZZFCXZNRAIGNCL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|