C14H17FN6O4S — CID 137293528
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137293528) has the molecular formula C14H17FN6O4S and a molecular weight of 384.39 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137293528 |
| Molecular Formula | C14H17FN6O4S |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[2-[(methylsulfonimidoyl)amino]ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)NCCOc1nonc1/C(=N/[C@H]1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C14H17FN6O4S/c1-26(16,23)17-4-5-24-14-12(20-25-21-14)13(19-22)18-11-6-8-2-3-9(15)7-10(8)11/h2-3,7,11,22H,4-6H2,1H3,(H,18,19)(H2,16,17,23)/t11-,26?/m0/s1 |
| InChIKey | WOGWDAWDTQEUHZ-AIGWJHGLSA-N |
| XLogP | 0.79 |
| TPSA | 145.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|