C15H14FN7O3S — CID 137293537
4-[[(E)-2-(N-cyano-S-methylsulfonimidoyl)ethenyl]amino]-N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137293537) has the molecular formula C15H14FN7O3S and a molecular weight of 391.39 g/mol. Its IUPAC name is 4-[[(E)-2-(N-cyano-S-methylsulfonimidoyl)ethenyl]amino]-N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[[(E)-2-(N-cyano-S-methylsulfonimidoyl)ethenyl]amino]-N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137293537 |
| Molecular Formula | C15H14FN7O3S |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 4-[[(E)-2-(N-cyano-S-methylsulfonimidoyl)ethenyl]amino]-N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | C[S@](=O)(/C=C/Nc1nonc1/C(=N/[C@H]1Cc2ccc(F)cc21)NO)=NC#N |
| InChI | InChI=1S/C15H14FN7O3S/c1-27(25,19-8-17)5-4-18-14-13(22-26-23-14)15(21-24)20-12-6-9-2-3-10(16)7-11(9)12/h2-5,7,12,24H,6H2,1H3,(H,18,23)(H,20,21)/b5-4+/t12-,27-/m0/s1 |
| InChIKey | HNZUOQKJZVBCEA-RXYRHBJMSA-N |
| XLogP | 1.69 |
| TPSA | 148.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|