C15H17FN6O4S — CID 137293548
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-(methylsulfonimidoyl)azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137293548) has the molecular formula C15H17FN6O4S and a molecular weight of 396.40 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-(methylsulfonimidoyl)azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-(methylsulfonimidoyl)azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137293548 |
| Molecular Formula | C15H17FN6O4S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-(methylsulfonimidoyl)azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)N1CC(Oc2nonc2/C(=N/[C@H]2Cc3ccc(F)cc32)NO)C1 |
| InChI | InChI=1S/C15H17FN6O4S/c1-27(17,24)22-6-10(7-22)25-15-13(20-26-21-15)14(19-23)18-12-4-8-2-3-9(16)5-11(8)12/h2-3,5,10,12,17,23H,4,6-7H2,1H3,(H,18,19)/t12-,27?/m0/s1 |
| InChIKey | GHAFCQJOBFFBQZ-JHQHAWHRSA-N |
| XLogP | 0.89 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|