C17H19FN6O5S — CID 137293566
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-[2-(methylsulfonimidoyl)acetyl]azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137293566) has the molecular formula C17H19FN6O5S and a molecular weight of 438.44 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-[2-(methylsulfonimidoyl)acetyl]azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-[2-(methylsulfonimidoyl)acetyl]azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137293566 |
| Molecular Formula | C17H19FN6O5S |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[1-[2-(methylsulfonimidoyl)acetyl]azetidin-3-yl]oxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)CC(=O)N1CC(Oc2nonc2/C(=N/[C@H]2Cc3ccc(F)cc32)NO)C1 |
| InChI | InChI=1S/C17H19FN6O5S/c1-30(19,27)8-14(25)24-6-11(7-24)28-17-15(22-29-23-17)16(21-26)20-13-4-9-2-3-10(18)5-12(9)13/h2-3,5,11,13,19,26H,4,6-8H2,1H3,(H,20,21)/t13-,30?/m0/s1 |
| InChIKey | DBNFACZVSLXJNC-LGHQJEIQSA-N |
| XLogP | 0.50 |
| TPSA | 154.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|