C23H22N8O4 — CID 137294008
N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(1H-indol-2-yl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 137294008) has the molecular formula C23H22N8O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(1H-indol-2-yl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(1H-indol-2-yl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 137294008 |
| Molecular Formula | C23H22N8O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-[2-[(4-amino-6,7-dimethoxyquinazolin-2-yl)amino]ethyl]-5-(1H-indol-2-yl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COc1cc2nc(NCCNC(=O)c3nnc(-c4cc5ccccc5[nH]4)o3)nc(N)c2cc1OC |
| InChI | InChI=1S/C23H22N8O4/c1-33-17-10-13-15(11-18(17)34-2)28-23(29-19(13)24)26-8-7-25-20(32)22-31-30-21(35-22)16-9-12-5-3-4-6-14(12)27-16/h3-6,9-11,27H,7-8H2,1-2H3,(H,25,32)(H3,24,26,28,29) |
| InChIKey | GSMPEVSVQSGQKO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 166.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|