C17H15ClN6 — CID 137294023
9-(3-chloro-4-pyridinyl)-13-ethyl-6-methyl-2,4,5,8,12-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene (PubChem CID 137294023) has the molecular formula C17H15ClN6 and a molecular weight of 338.80 g/mol. Its IUPAC name is 9-(3-chloro-4-pyridinyl)-13-ethyl-6-methyl-2,4,5,8,12-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene.
| Compound Name | 9-(3-chloro-4-pyridinyl)-13-ethyl-6-methyl-2,4,5,8,12-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene |
|---|---|
| PubChem CID | 137294023 |
| Molecular Formula | C17H15ClN6 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 9-(3-chloro-4-pyridinyl)-13-ethyl-6-methyl-2,4,5,8,12-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene |
| SMILES | CCc1cc2c(cn1)C(c1ccncc1Cl)=Nc1c(n[nH]c1C)N2 |
| InChI | InChI=1S/C17H15ClN6/c1-3-10-6-14-12(7-20-10)16(11-4-5-19-8-13(11)18)22-15-9(2)23-24-17(15)21-14/h4-8H,3H2,1-2H3,(H2,21,23,24) |
| InChIKey | BXODIGIILXASBX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |