About 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol
2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol (PubChem CID 137294189) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol |
| PubChem CID | 137294189 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cccc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2ccncc2)c1O |
| InChI | InChI=1S/C23H29N3O/c1-23(2,3)19-8-6-7-18(22(19)27)16-26-21-10-5-4-9-20(21)25-15-17-11-13-24-14-12-17/h6-8,11-16,20-21,27H,4-5,9-10H2,1-3H3/b25-15+,26-16+/t20-,21-/m1/s1 |
| InChIKey | SKIJYCJWWSYNCO-RVGXILALSA-N |
| XLogP | 4.93 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol?
The IUPAC name of 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol (CID 137294189) is 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol.
What is the SMILES notation for 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol?
The canonical SMILES for 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol is CC(C)(C)c1cccc(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2ccncc2)c1O.
What is the InChIKey of 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol?
The InChIKey is SKIJYCJWWSYNCO-RVGXILALSA-N. The full InChI is InChI=1S/C23H29N3O/c1-23(2,3)19-8-6-7-18(22(19)27)16-26-21-10-5-4-9-20(21)25-15-17-11-13-24-14-12-17/h6-8,11-16,20-21,27H,4-5,9-10H2,1-3H3/b25-15+,26-16+/t20-,21-/m1/s1.
What are the key properties of 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol?
2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol has a molecular weight of 363.51 g/mol, XLogP of 4.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-[[(1R,2R)-2-(pyridin-4-ylmethylideneamino)cyclohexyl]iminomethyl]phenol is sourced from PubChem (CID 137294189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).