About ethyl 2-diazoacetate
ethyl 2-diazoacetate (PubChem CID 137294213) has the molecular formula C4H6N2O2
and a molecular weight of 115.10 g/mol. Its IUPAC name is ethyl 2-diazoacetate.
Molecular Properties
| Compound Name | ethyl 2-diazoacetate |
| PubChem CID | 137294213 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 115.10 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | ethyl 2-diazoacetate |
| SMILES | CCOC(=O)[13CH]=[N+]=[N-] |
| InChI | InChI=1S/C4H6N2O2/c1-2-8-4(7)3-6-5/h3H,2H2,1H3/i3+1 |
| InChIKey | YVPJCJLMRRTDMQ-LBPDFUHNSA-N |
| XLogP | -0.15 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.10 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-diazoacetate?
The IUPAC name of ethyl 2-diazoacetate (CID 137294213) is ethyl 2-diazoacetate.
What is the SMILES notation for ethyl 2-diazoacetate?
The canonical SMILES for ethyl 2-diazoacetate is CCOC(=O)[13CH]=[N+]=[N-].
What is the InChIKey of ethyl 2-diazoacetate?
The InChIKey is YVPJCJLMRRTDMQ-LBPDFUHNSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-2-8-4(7)3-6-5/h3H,2H2,1H3/i3+1.
What are the key properties of ethyl 2-diazoacetate?
ethyl 2-diazoacetate has a molecular weight of 115.10 g/mol, XLogP of -0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-diazoacetate is sourced from PubChem (CID 137294213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).