C23H33N5O3 — CID 137294523
N-[3-[benzyl(methyl)amino]propyl]-3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 137294523) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 137294523 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3-(4-methyl-2-morpholin-4-yl-6-oxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | Cc1nc(N2CCOCC2)[nH]c(=O)c1CCC(=O)NCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H33N5O3/c1-18-20(22(30)26-23(25-18)28-13-15-31-16-14-28)9-10-21(29)24-11-6-12-27(2)17-19-7-4-3-5-8-19/h3-5,7-8H,6,9-17H2,1-2H3,(H,24,29)(H,25,26,30) |
| InChIKey | SKJHUIAAPUTAFD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|