C22H25N7O — CID 137294777
(Z)-3-(2-methoxyethylamino)-N'-(8-methyl-9-phenyl-5,6-dihydropyrazolo[3,4-h]quinazolin-2-yl)prop-2-enimidamide (PubChem CID 137294777) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is (Z)-3-(2-methoxyethylamino)-N'-(8-methyl-9-phenyl-5,6-dihydropyrazolo[3,4-h]quinazolin-2-yl)prop-2-enimidamide.
| Compound Name | (Z)-3-(2-methoxyethylamino)-N'-(8-methyl-9-phenyl-5,6-dihydropyrazolo[3,4-h]quinazolin-2-yl)prop-2-enimidamide |
|---|---|
| PubChem CID | 137294777 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (Z)-3-(2-methoxyethylamino)-N'-(8-methyl-9-phenyl-5,6-dihydropyrazolo[3,4-h]quinazolin-2-yl)prop-2-enimidamide |
| SMILES | COCCN/C=C\C(N)=N/c1ncc2c(n1)-c1c(nn(C)c1-c1ccccc1)CC2 |
| InChI | InChI=1S/C22H25N7O/c1-29-21(15-6-4-3-5-7-15)19-17(28-29)9-8-16-14-25-22(27-20(16)19)26-18(23)10-11-24-12-13-30-2/h3-7,10-11,14,24H,8-9,12-13H2,1-2H3,(H2,23,25,26,27)/b11-10- |
| InChIKey | OHWMFLQGESAXQS-KHPPLWFESA-N |
| XLogP | 2.38 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|