C22H28BN3Si — CID 137295080
triethyl-[4-methyl-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]silane (PubChem CID 137295080) has the molecular formula C22H28BN3Si and a molecular weight of 373.39 g/mol. Its IUPAC name is triethyl-[4-methyl-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]silane.
| Compound Name | triethyl-[4-methyl-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]silane |
|---|---|
| PubChem CID | 137295080 |
| Molecular Formula | C22H28BN3Si |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | triethyl-[4-methyl-2-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)phenyl]silane |
| SMILES | CC[Si](CC)(CC)c1ccc(C)cc1B1Nc2ccccc2-c2ccnn21 |
| InChI | InChI=1S/C22H28BN3Si/c1-5-27(6-2,7-3)22-13-12-17(4)16-19(22)23-25-20-11-9-8-10-18(20)21-14-15-24-26(21)23/h8-16,25H,5-7H2,1-4H3 |
| InChIKey | AATVCCGIYPUSOP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|