About methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate
methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate (PubChem CID 137295327) has the molecular formula C14H10O7
and a molecular weight of 290.23 g/mol. Its IUPAC name is methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 137295327 |
| Molecular Formula | C14H10O7 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=C(c2c(O)cc(C)oc2=O)C=CC(=O)C1=O |
| InChI | InChI=1S/C14H10O7/c1-6-5-9(16)10(14(19)21-6)7-3-4-8(15)12(17)11(7)13(18)20-2/h3-5,16H,1-2H3 |
| InChIKey | NMGJDTAKAFCMKX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate (CID 137295327) is methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=C(c2c(O)cc(C)oc2=O)C=CC(=O)C1=O.
What is the InChIKey of methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate?
The InChIKey is NMGJDTAKAFCMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O7/c1-6-5-9(16)10(14(19)21-6)7-3-4-8(15)12(17)11(7)13(18)20-2/h3-5,16H,1-2H3.
What are the key properties of methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate?
methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate has a molecular weight of 290.23 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-5,6-dioxocyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 137295327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).