C80H92Br2 — CID 137295359
1-bromo-16-(16-bromo-3,6,11,14-tetratert-butyltetraphenylen-1-yl)-3,6,11,14-tetratert-butyltetraphenylene (PubChem CID 137295359) has the molecular formula C80H92Br2 and a molecular weight of 1213.42 g/mol. Its IUPAC name is 1-bromo-16-(16-bromo-3,6,11,14-tetratert-butyltetraphenylen-1-yl)-3,6,11,14-tetratert-butyltetraphenylene.
| Compound Name | 1-bromo-16-(16-bromo-3,6,11,14-tetratert-butyltetraphenylen-1-yl)-3,6,11,14-tetratert-butyltetraphenylene |
|---|---|
| PubChem CID | 137295359 |
| Molecular Formula | C80H92Br2 |
| Molecular Weight | 1213.42 g/mol |
| Exact Mass | 1210.56 |
| IUPAC Name | 1-bromo-16-(16-bromo-3,6,11,14-tetratert-butyltetraphenylen-1-yl)-3,6,11,14-tetratert-butyltetraphenylene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)cc(Br)c1-c1c(cc(C(C)(C)C)cc1-c1cc(C(C)(C)C)cc3c1-c1c(Br)cc(C(C)(C)C)cc1-c1cc(C(C)(C)C)ccc1-c1ccc(C(C)(C)C)cc1-3)-c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C80H92Br2/c1-73(2,3)45-25-29-53-55-31-27-47(75(7,8)9)35-59(55)63-41-51(79(19,20)21)43-67(81)71(63)69-61(57(53)33-45)37-49(77(13,14)15)39-65(69)66-40-50(78(16,17)18)38-62-58-34-46(74(4,5)6)26-30-54(58)56-32-28-48(76(10,11)12)36-60(56)64-42-52(80(22,23)24)44-68(82)72(64)70(62)66/h25-44H,1-24H3/b55-53-,56-54-,61-57-,62-58-,63-59-,64-60-,71-69-,72-70- |
| InChIKey | JZJMCJZXKRJCGP-WDKKQQTQSA-N |
| XLogP | 25.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1213.42 |
| LogP ≤ 5 | 25.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |