C25H31NO6 — CID 137295477
dibutyl (2R,5S,6S,7R)-3-benzyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxylate (PubChem CID 137295477) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is dibutyl (2R,5S,6S,7R)-3-benzyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxylate.
| Compound Name | dibutyl (2R,5S,6S,7R)-3-benzyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 137295477 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | dibutyl (2R,5S,6S,7R)-3-benzyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1[C@H]2C=CC3(O2)[C@H](C(=O)OCCCC)N(Cc2ccccc2)C(=O)[C@@H]13 |
| InChI | InChI=1S/C25H31NO6/c1-3-5-14-30-23(28)19-18-12-13-25(32-18)20(19)22(27)26(16-17-10-8-7-9-11-17)21(25)24(29)31-15-6-4-2/h7-13,18-21H,3-6,14-16H2,1-2H3/t18-,19-,20-,21+,25?/m1/s1 |
| InChIKey | YFIBLPZWSMGEQM-SMIGFMFVSA-N |
| XLogP | 3.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|