About 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid
2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 137295551) has the molecular formula C21H18N2O6
and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid |
| PubChem CID | 137295551 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | COc1ccccc1/N=C1\C(=O)C=C(Nc2ccccc2OC)C(O)=C1C(=O)O |
| InChI | InChI=1S/C21H18N2O6/c1-28-16-9-5-3-7-12(16)22-14-11-15(24)19(18(20(14)25)21(26)27)23-13-8-4-6-10-17(13)29-2/h3-11,22,25H,1-2H3,(H,26,27)/b23-19+ |
| InChIKey | BWMZPOWSJDRTOW-FCDQGJHFSA-N |
| XLogP | 3.25 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
The IUPAC name of 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid (CID 137295551) is 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid.
What is the SMILES notation for 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
The canonical SMILES for 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid is COc1ccccc1/N=C1\C(=O)C=C(Nc2ccccc2OC)C(O)=C1C(=O)O.
What is the InChIKey of 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
The InChIKey is BWMZPOWSJDRTOW-FCDQGJHFSA-N. The full InChI is InChI=1S/C21H18N2O6/c1-28-16-9-5-3-7-12(16)22-14-11-15(24)19(18(20(14)25)21(26)27)23-13-8-4-6-10-17(13)29-2/h3-11,22,25H,1-2H3,(H,26,27)/b23-19+.
What are the key properties of 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid?
2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid has a molecular weight of 394.38 g/mol, XLogP of 3.25, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-(2-methoxyanilino)-6-(2-methoxyphenyl)imino-5-oxocyclohexa-1,3-diene-1-carboxylic acid is sourced from PubChem (CID 137295551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).