C13H37N2PSi4 — CID 137295583
[(Z)-[bis(trimethylsilyl)amino]-(trimethylsilylmethylidene)phosphaniumyl]-trimethylsilylazanide (PubChem CID 137295583) has the molecular formula C13H37N2PSi4 and a molecular weight of 364.77 g/mol. Its IUPAC name is [(Z)-[bis(trimethylsilyl)amino]-(trimethylsilylmethylidene)phosphaniumyl]-trimethylsilylazanide.
| Compound Name | [(Z)-[bis(trimethylsilyl)amino]-(trimethylsilylmethylidene)phosphaniumyl]-trimethylsilylazanide |
|---|---|
| PubChem CID | 137295583 |
| Molecular Formula | C13H37N2PSi4 |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [(Z)-[bis(trimethylsilyl)amino]-(trimethylsilylmethylidene)phosphaniumyl]-trimethylsilylazanide |
| SMILES | C[Si](C)(C)/C=[P+](/[N-][Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H37N2PSi4/c1-17(2,3)13-16(14-18(4,5)6)15(19(7,8)9)20(10,11)12/h13H,1-12H3 |
| InChIKey | CTAJEFQPNDQZQL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|