About CID 137295730
CID 137295730 (PubChem CID 137295730) has the molecular formula C21H29Si2
and a molecular weight of 337.64 g/mol.
Molecular Properties
| Compound Name | CID 137295730 |
| PubChem CID | 137295730 |
| Molecular Formula | C21H29Si2 |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | — |
| SMILES | CC(C)[Si](c1ccc2ccccc2c1C#C[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C21H29Si2/c1-16(2)22(17(3)4)21-13-12-18-10-8-9-11-19(18)20(21)14-15-23(5,6)7/h8-13,16-17H,1-7H3 |
| InChIKey | VRSNIZYLYSQSRU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 137295730 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137295730?
The IUPAC name of CID 137295730 (CID 137295730) is not available.
What is the SMILES notation for CID 137295730?
The canonical SMILES for CID 137295730 is CC(C)[Si](c1ccc2ccccc2c1C#C[Si](C)(C)C)C(C)C.
What is the InChIKey of CID 137295730?
The InChIKey is VRSNIZYLYSQSRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29Si2/c1-16(2)22(17(3)4)21-13-12-18-10-8-9-11-19(18)20(21)14-15-23(5,6)7/h8-13,16-17H,1-7H3.
What are the key properties of CID 137295730?
CID 137295730 has a molecular weight of 337.64 g/mol, XLogP of 5.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137295730 is sourced from PubChem (CID 137295730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).