C20H15FN2OS — CID 137295750
(Z)-2-[6-(3-fluorophenyl)-4-methylpyrrolo[1,2-a]pyrazin-1-yl]-1-thiophen-2-ylethenol (PubChem CID 137295750) has the molecular formula C20H15FN2OS and a molecular weight of 350.42 g/mol. Its IUPAC name is (Z)-2-[6-(3-fluorophenyl)-4-methylpyrrolo[1,2-a]pyrazin-1-yl]-1-thiophen-2-ylethenol.
| Compound Name | (Z)-2-[6-(3-fluorophenyl)-4-methylpyrrolo[1,2-a]pyrazin-1-yl]-1-thiophen-2-ylethenol |
|---|---|
| PubChem CID | 137295750 |
| Molecular Formula | C20H15FN2OS |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (Z)-2-[6-(3-fluorophenyl)-4-methylpyrrolo[1,2-a]pyrazin-1-yl]-1-thiophen-2-ylethenol |
| SMILES | Cc1cnc(/C=C(\O)c2cccs2)c2ccc(-c3cccc(F)c3)n12 |
| InChI | InChI=1S/C20H15FN2OS/c1-13-12-22-16(11-19(24)20-6-3-9-25-20)18-8-7-17(23(13)18)14-4-2-5-15(21)10-14/h2-12,24H,1H3/b19-11- |
| InChIKey | CZVPOMNPMIGPEM-ODLFYWEKSA-N |
| XLogP | 5.57 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|