C18H21F6N4O6P — CID 137295780
[3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-methylmorpholin-4-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid (PubChem CID 137295780) has the molecular formula C18H21F6N4O6P and a molecular weight of 534.35 g/mol. Its IUPAC name is [3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-methylmorpholin-4-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid.
| Compound Name | [3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-methylmorpholin-4-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 137295780 |
| Molecular Formula | C18H21F6N4O6P |
| Molecular Weight | 534.35 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | [3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-methylmorpholin-4-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid |
| SMILES | C[C@@H](O[C@H]1OCCN(Cc2nn(P(=O)(O)O)c(=O)[nH]2)[C@H]1C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H21F6N4O6P/c1-9-15(33-4-3-27(9)8-14-25-16(29)28(26-14)35(30,31)32)34-10(2)11-5-12(17(19,20)21)7-13(6-11)18(22,23)24/h5-7,9-10,15H,3-4,8H2,1-2H3,(H,25,26,29)(H2,30,31,32)/t9-,10+,15+/m0/s1 |
| InChIKey | GHNOODMCXZFFNB-FEUHOPSXSA-N |
| XLogP | 2.87 |
| TPSA | 129.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|