C22H27N6OP — CID 137296206
2-(3-phosphanylpyrrolidin-1-yl)-4-(piperidin-3-ylamino)-5-quinolin-2-yl-1H-pyrimidin-6-one (PubChem CID 137296206) has the molecular formula C22H27N6OP and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-(3-phosphanylpyrrolidin-1-yl)-4-(piperidin-3-ylamino)-5-quinolin-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-phosphanylpyrrolidin-1-yl)-4-(piperidin-3-ylamino)-5-quinolin-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137296206 |
| Molecular Formula | C22H27N6OP |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-(3-phosphanylpyrrolidin-1-yl)-4-(piperidin-3-ylamino)-5-quinolin-2-yl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(N2CCC(P)C2)nc(NC2CCCNC2)c1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H27N6OP/c29-21-19(18-8-7-14-4-1-2-6-17(14)25-18)20(24-15-5-3-10-23-12-15)26-22(27-21)28-11-9-16(30)13-28/h1-2,4,6-8,15-16,23H,3,5,9-13,30H2,(H2,24,26,27,29) |
| InChIKey | HFMOAVCZVDGAJP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|