C6H10N6O3S — CID 137296270
2-amino-3-[[4-[(Z)-N'-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanamide (PubChem CID 137296270) has the molecular formula C6H10N6O3S and a molecular weight of 246.25 g/mol. Its IUPAC name is 2-amino-3-[[4-[(Z)-N'-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanamide.
| Compound Name | 2-amino-3-[[4-[(Z)-N'-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 137296270 |
| Molecular Formula | C6H10N6O3S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-amino-3-[[4-[(Z)-N'-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]propanamide |
| SMILES | NC(=O)C(N)CSc1nonc1/C(N)=N/O |
| InChI | InChI=1S/C6H10N6O3S/c7-2(5(9)13)1-16-6-3(4(8)10-14)11-15-12-6/h2,14H,1,7H2,(H2,8,10)(H2,9,13) |
| InChIKey | POFKCRKCIVEXGS-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 166.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|