C13H13FN6O3 — CID 137296293
2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]acetamide (PubChem CID 137296293) has the molecular formula C13H13FN6O3 and a molecular weight of 320.28 g/mol. Its IUPAC name is 2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]acetamide.
| Compound Name | 2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]acetamide |
|---|---|
| PubChem CID | 137296293 |
| Molecular Formula | C13H13FN6O3 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]amino]acetamide |
| SMILES | NC(=O)CNc1nonc1/C(=N/C1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C13H13FN6O3/c14-7-2-1-6-3-9(8(6)4-7)17-13(18-22)11-12(20-23-19-11)16-5-10(15)21/h1-2,4,9,22H,3,5H2,(H2,15,21)(H,16,20)(H,17,18) |
| InChIKey | QJYGLXHNUKZVOQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|