C23H13F5N4 — CID 137296835
(2Z)-2-[(2,3,4,5,6-pentafluorophenyl)-[5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole (PubChem CID 137296835) has the molecular formula C23H13F5N4 and a molecular weight of 440.38 g/mol. Its IUPAC name is (2Z)-2-[(2,3,4,5,6-pentafluorophenyl)-[5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole.
| Compound Name | (2Z)-2-[(2,3,4,5,6-pentafluorophenyl)-[5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole |
|---|---|
| PubChem CID | 137296835 |
| Molecular Formula | C23H13F5N4 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (2Z)-2-[(2,3,4,5,6-pentafluorophenyl)-[5-(1H-pyrrol-2-yl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole |
| SMILES | Fc1c(F)c(F)c(/C(=C2\C=CC(c3ccc[nH]3)=N2)c2ccc(-c3ccc[nH]3)[nH]2)c(F)c1F |
| InChI | InChI=1S/C23H13F5N4/c24-19-18(20(25)22(27)23(28)21(19)26)17(15-7-5-13(31-15)11-3-1-9-29-11)16-8-6-14(32-16)12-4-2-10-30-12/h1-10,29-31H/b17-16+ |
| InChIKey | INHYLCNBKXPUJX-WUKNDPDISA-N |
| XLogP | 5.85 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|