C19H20FN7O4 — CID 137297315
4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)amino]-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137297315) has the molecular formula C19H20FN7O4 and a molecular weight of 429.41 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)amino]-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)amino]-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137297315 |
| Molecular Formula | C19H20FN7O4 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-8-yl)amino]-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=C1NC(=O)C2(CCC(Nc3nonc3/C(=N\C3Cc4ccc(F)cc43)NO)CC2)N1 |
| InChI | InChI=1S/C19H20FN7O4/c20-10-2-1-9-7-13(12(9)8-10)22-15(25-30)14-16(27-31-26-14)21-11-3-5-19(6-4-11)17(28)23-18(29)24-19/h1-2,8,11,13,30H,3-7H2,(H,21,27)(H,22,25)(H2,23,24,28,29) |
| InChIKey | UPPAOJAPCSBLMR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|