About 3,8-dihydropyrrolo[2,3-c]diazepine
3,8-dihydropyrrolo[2,3-c]diazepine (PubChem CID 137297957) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 3,8-dihydropyrrolo[2,3-c]diazepine.
Molecular Properties
| Compound Name | 3,8-dihydropyrrolo[2,3-c]diazepine |
| PubChem CID | 137297957 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 3,8-dihydropyrrolo[2,3-c]diazepine |
| SMILES | C1=Cc2cc[nH]c2N=NC1 |
| InChI | InChI=1S/C7H7N3/c1-2-6-3-5-8-7(6)10-9-4-1/h1-3,5,8H,4H2 |
| InChIKey | UFMNCXGROYPPBK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,8-dihydropyrrolo[2,3-c]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dihydropyrrolo[2,3-c]diazepine?
The IUPAC name of 3,8-dihydropyrrolo[2,3-c]diazepine (CID 137297957) is 3,8-dihydropyrrolo[2,3-c]diazepine.
What is the SMILES notation for 3,8-dihydropyrrolo[2,3-c]diazepine?
The canonical SMILES for 3,8-dihydropyrrolo[2,3-c]diazepine is C1=Cc2cc[nH]c2N=NC1.
What is the InChIKey of 3,8-dihydropyrrolo[2,3-c]diazepine?
The InChIKey is UFMNCXGROYPPBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-2-6-3-5-8-7(6)10-9-4-1/h1-3,5,8H,4H2.
What are the key properties of 3,8-dihydropyrrolo[2,3-c]diazepine?
3,8-dihydropyrrolo[2,3-c]diazepine has a molecular weight of 133.15 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dihydropyrrolo[2,3-c]diazepine is sourced from PubChem (CID 137297957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).